About [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate
[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate (PubChem CID 153294117) has the molecular formula C19H32O7
and a molecular weight of 372.46 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate.
Molecular Properties
| Compound Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate |
| PubChem CID | 153294117 |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)CCCCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C19H32O7/c1-6-19(4,5)18(23)24-11-9-7-8-10-16(21)25-12-15(20)13-26-17(22)14(2)3/h15,20H,2,6-13H2,1,3-5H3 |
| InChIKey | DDRABRVAYHSKIV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate?
The IUPAC name of [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate (CID 153294117) is [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate.
What is the SMILES notation for [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate?
The canonical SMILES for [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate is C=C(C)C(=O)OCC(O)COC(=O)CCCCCOC(=O)C(C)(C)CC.
What is the InChIKey of [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate?
The InChIKey is DDRABRVAYHSKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O7/c1-6-19(4,5)18(23)24-11-9-7-8-10-16(21)25-12-15(20)13-26-17(22)14(2)3/h15,20H,2,6-13H2,1,3-5H3.
What are the key properties of [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate?
[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate has a molecular weight of 372.46 g/mol, XLogP of 2.55, 13 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate is sourced from PubChem (CID 153294117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).