C75H72B3N3O6 — CID 153295103
5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]-2,4,6-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-phenylpyridine (PubChem CID 153295103) has the molecular formula C75H72B3N3O6 and a molecular weight of 1143.85 g/mol. Its IUPAC name is 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]-2,4,6-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-phenylpyridine.
| Compound Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]-2,4,6-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-phenylpyridine |
|---|---|
| PubChem CID | 153295103 |
| Molecular Formula | C75H72B3N3O6 |
| Molecular Weight | 1143.85 g/mol |
| Exact Mass | 1143.57 |
| IUPAC Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]-2,4,6-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-phenylpyridine |
| SMILES | CC1(C)OB(c2c(-c3ccccc3-c3ccc(-c4ccccc4)nc3)c(B3OC(C)(C)C(C)(C)O3)c(-c3ccccc3-c3ccc(-c4ccccc4)nc3)c(B3OC(C)(C)C(C)(C)O3)c2-c2ccccc2-c2ccc(-c3ccccc3)nc2)OC1(C)C |
| InChI | InChI=1S/C75H72B3N3O6/c1-70(2)71(3,4)83-76(82-70)67-64(58-37-25-22-34-55(58)52-40-43-61(79-46-52)49-28-16-13-17-29-49)68(77-84-72(5,6)73(7,8)85-77)66(60-39-27-24-36-57(60)54-42-45-63(81-48-54)51-32-20-15-21-33-51)69(78-86-74(9,10)75(11,12)87-78)65(67)59-38-26-23-35-56(59)53-41-44-62(80-47-53)50-30-18-14-19-31-50/h13-48H,1-12H3 |
| InChIKey | QAGWCZCLUXDIKQ-UHFFFAOYSA-N |
| XLogP | 15.77 |
| TPSA | 94.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1143.85 |
| LogP ≤ 5 | 15.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|