C9H17N3 — CID 153295477
(3S)-4-amino-1-propan-2-ylpiperidine-3-carbonitrile (PubChem CID 153295477) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (3S)-4-amino-1-propan-2-ylpiperidine-3-carbonitrile.
| Compound Name | (3S)-4-amino-1-propan-2-ylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 153295477 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (3S)-4-amino-1-propan-2-ylpiperidine-3-carbonitrile |
| SMILES | CC(C)N1CCC(N)[C@@H](C#N)C1 |
| InChI | InChI=1S/C9H17N3/c1-7(2)12-4-3-9(11)8(5-10)6-12/h7-9H,3-4,6,11H2,1-2H3/t8-,9?/m0/s1 |
| InChIKey | AIJMOFCVEFONRQ-IENPIDJESA-N |
| XLogP | 0.57 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |