About potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide
potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide (PubChem CID 153295512) has the molecular formula C8H11KNO3-
and a molecular weight of 208.28 g/mol. Its IUPAC name is potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide.
Molecular Properties
| Compound Name | potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide |
| PubChem CID | 153295512 |
| Molecular Formula | C8H11KNO3- |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide |
| SMILES | CC(C)(C)c1coc([C-]=O)n1.[K+].[OH-] |
| InChI | InChI=1S/C8H10NO2.K.H2O/c1-8(2,3)6-5-11-7(4-10)9-6;;/h5H,1-3H3;;1H2/q-1;+1;/p-1 |
| InChIKey | XQVIHXOEMNZNAB-UHFFFAOYSA-M |
| XLogP | -1.74 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide?
The IUPAC name of potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide (CID 153295512) is potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide.
What is the SMILES notation for potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide?
The canonical SMILES for potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide is CC(C)(C)c1coc([C-]=O)n1.[K+].[OH-].
What is the InChIKey of potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide?
The InChIKey is XQVIHXOEMNZNAB-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10NO2.K.H2O/c1-8(2,3)6-5-11-7(4-10)9-6;;/h5H,1-3H3;;1H2/q-1;+1;/p-1.
What are the key properties of potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide?
potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide has a molecular weight of 208.28 g/mol, XLogP of -1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;(4-tert-butyl-1,3-oxazol-2-yl)methanone;hydroxide is sourced from PubChem (CID 153295512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).