C18H30Si2 — CID 15329683
1,2,3,4,5-pentamethyl-1-(1,2,3,4,5-pentamethylsilol-1-yl)silole (PubChem CID 15329683) has the molecular formula C18H30Si2 and a molecular weight of 302.61 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-1-(1,2,3,4,5-pentamethylsilol-1-yl)silole.
| Compound Name | 1,2,3,4,5-pentamethyl-1-(1,2,3,4,5-pentamethylsilol-1-yl)silole |
|---|---|
| PubChem CID | 15329683 |
| Molecular Formula | C18H30Si2 |
| Molecular Weight | 302.61 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-1-(1,2,3,4,5-pentamethylsilol-1-yl)silole |
| SMILES | CC1=C(C)[Si](C)([Si]2(C)C(C)=C(C)C(C)=C2C)C(C)=C1C |
| InChI | InChI=1S/C18H30Si2/c1-11-12(2)16(6)19(9,15(11)5)20(10)17(7)13(3)14(4)18(20)8/h1-10H3 |
| InChIKey | MYHXFXRZPDAQPD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|