About 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine
6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine (PubChem CID 153297342) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine.
Molecular Properties
| Compound Name | 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine |
| PubChem CID | 153297342 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine |
| SMILES | CC(C)c1cc2c(nn1)CN=N2 |
| InChI | InChI=1S/C8H10N4/c1-5(2)6-3-7-8(12-11-6)4-9-10-7/h3,5H,4H2,1-2H3 |
| InChIKey | NAYIJABADWFMTB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine?
The IUPAC name of 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine (CID 153297342) is 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine.
What is the SMILES notation for 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine?
The canonical SMILES for 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine is CC(C)c1cc2c(nn1)CN=N2.
What is the InChIKey of 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine?
The InChIKey is NAYIJABADWFMTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-5(2)6-3-7-8(12-11-6)4-9-10-7/h3,5H,4H2,1-2H3.
What are the key properties of 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine?
6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine has a molecular weight of 162.20 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-3H-pyrazolo[4,3-c]pyridazine is sourced from PubChem (CID 153297342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).