C62H39N5O — CID 153297864
2-[7-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]spiro[fluorene-9,9'-xanthene]-4-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 153297864) has the molecular formula C62H39N5O and a molecular weight of 870.03 g/mol. Its IUPAC name is 2-[7-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]spiro[fluorene-9,9'-xanthene]-4-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[7-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]spiro[fluorene-9,9'-xanthene]-4-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 153297864 |
| Molecular Formula | C62H39N5O |
| Molecular Weight | 870.03 g/mol |
| Exact Mass | 869.32 |
| IUPAC Name | 2-[7-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]spiro[fluorene-9,9'-xanthene]-4-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(-c4ccc5c(c4)C4(c6ccccc6Oc6ccccc64)c4cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c4-5)cc3)n2)cc1 |
| InChI | InChI=1S/C62H39N5O/c1-5-18-41(19-6-1)53-39-54(42-20-7-2-8-21-42)64-58(63-53)45-34-32-40(33-35-45)46-36-37-47-52(38-46)62(49-27-13-15-30-55(49)68-56-31-16-14-28-50(56)62)51-29-17-26-48(57(47)51)61-66-59(43-22-9-3-10-23-43)65-60(67-61)44-24-11-4-12-25-44/h1-39H |
| InChIKey | HBUKGMPNVDIHEQ-UHFFFAOYSA-N |
| XLogP | 14.80 |
| TPSA | 73.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.03 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |