C55H34N6O — CID 153297866
2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 153297866) has the molecular formula C55H34N6O and a molecular weight of 794.92 g/mol. Its IUPAC name is 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 153297866 |
| Molecular Formula | C55H34N6O |
| Molecular Weight | 794.92 g/mol |
| Exact Mass | 794.28 |
| IUPAC Name | 2-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)-c3ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc3C43c4ccccc4Oc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C55H34N6O/c1-5-17-35(18-6-1)49-56-50(36-19-7-2-8-20-36)59-53(58-49)39-30-32-43-42(33-39)41-31-29-40(34-46(41)55(43)44-25-13-15-27-47(44)62-48-28-16-14-26-45(48)55)54-60-51(37-21-9-3-10-22-37)57-52(61-54)38-23-11-4-12-24-38/h1-34H |
| InChIKey | WSWFXVMWVGATNK-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 86.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.92 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |