C18H29IN4O2 — CID 153298189
5-iodo-1-N,3-N-bis(2-morpholin-4-ylethyl)benzene-1,3-diamine (PubChem CID 153298189) has the molecular formula C18H29IN4O2 and a molecular weight of 460.36 g/mol. Its IUPAC name is 5-iodo-1-N,3-N-bis(2-morpholin-4-ylethyl)benzene-1,3-diamine.
| Compound Name | 5-iodo-1-N,3-N-bis(2-morpholin-4-ylethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 153298189 |
| Molecular Formula | C18H29IN4O2 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 5-iodo-1-N,3-N-bis(2-morpholin-4-ylethyl)benzene-1,3-diamine |
| SMILES | Ic1cc(NCCN2CCOCC2)cc(NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C18H29IN4O2/c19-16-13-17(20-1-3-22-5-9-24-10-6-22)15-18(14-16)21-2-4-23-7-11-25-12-8-23/h13-15,20-21H,1-12H2 |
| InChIKey | VFTWNKYXNBEHGH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|