About 2-phenyl-5,7-diazaspiro[3.4]octan-6-one
2-phenyl-5,7-diazaspiro[3.4]octan-6-one (PubChem CID 153298237) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-phenyl-5,7-diazaspiro[3.4]octan-6-one.
Molecular Properties
| Compound Name | 2-phenyl-5,7-diazaspiro[3.4]octan-6-one |
| PubChem CID | 153298237 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-phenyl-5,7-diazaspiro[3.4]octan-6-one |
| SMILES | O=C1NCC2(CC(c3ccccc3)C2)N1 |
| InChI | InChI=1S/C12H14N2O/c15-11-13-8-12(14-11)6-10(7-12)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,13,14,15) |
| InChIKey | ZATWVCZCUPBJAX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenyl-5,7-diazaspiro[3.4]octan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-5,7-diazaspiro[3.4]octan-6-one?
The IUPAC name of 2-phenyl-5,7-diazaspiro[3.4]octan-6-one (CID 153298237) is 2-phenyl-5,7-diazaspiro[3.4]octan-6-one.
What is the SMILES notation for 2-phenyl-5,7-diazaspiro[3.4]octan-6-one?
The canonical SMILES for 2-phenyl-5,7-diazaspiro[3.4]octan-6-one is O=C1NCC2(CC(c3ccccc3)C2)N1.
What is the InChIKey of 2-phenyl-5,7-diazaspiro[3.4]octan-6-one?
The InChIKey is ZATWVCZCUPBJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c15-11-13-8-12(14-11)6-10(7-12)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,13,14,15).
What are the key properties of 2-phenyl-5,7-diazaspiro[3.4]octan-6-one?
2-phenyl-5,7-diazaspiro[3.4]octan-6-one has a molecular weight of 202.26 g/mol, XLogP of 1.62, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-5,7-diazaspiro[3.4]octan-6-one is sourced from PubChem (CID 153298237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).