About 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine
4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine (PubChem CID 153298289) has the molecular formula C14H27FN2O
and a molecular weight of 258.38 g/mol. Its IUPAC name is 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine |
| PubChem CID | 153298289 |
| Molecular Formula | C14H27FN2O |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine |
| SMILES | C[C@@H]1[C@@H](CN2CCOCC2)[C@@H](F)CN1C(C)(C)C |
| InChI | InChI=1S/C14H27FN2O/c1-11-12(9-16-5-7-18-8-6-16)13(15)10-17(11)14(2,3)4/h11-13H,5-10H2,1-4H3/t11-,12-,13+/m1/s1 |
| InChIKey | QDWAHDRLKYKTKX-UPJWGTAASA-N |
| XLogP | 1.78 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine?
The IUPAC name of 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine (CID 153298289) is 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine.
What is the SMILES notation for 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine?
The canonical SMILES for 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine is C[C@@H]1[C@@H](CN2CCOCC2)[C@@H](F)CN1C(C)(C)C.
What is the InChIKey of 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine?
The InChIKey is QDWAHDRLKYKTKX-UPJWGTAASA-N. The full InChI is InChI=1S/C14H27FN2O/c1-11-12(9-16-5-7-18-8-6-16)13(15)10-17(11)14(2,3)4/h11-13H,5-10H2,1-4H3/t11-,12-,13+/m1/s1.
What are the key properties of 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine?
4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine has a molecular weight of 258.38 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2R,3R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]morpholine is sourced from PubChem (CID 153298289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).