C12H24F3N — CID 153298564
4,4-dimethyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]pentan-1-amine (PubChem CID 153298564) has the molecular formula C12H24F3N and a molecular weight of 239.32 g/mol. Its IUPAC name is 4,4-dimethyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]pentan-1-amine.
| Compound Name | 4,4-dimethyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]pentan-1-amine |
|---|---|
| PubChem CID | 153298564 |
| Molecular Formula | C12H24F3N |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 4,4-dimethyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]pentan-1-amine |
| SMILES | CC(C)[C@H](NCCCC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H24F3N/c1-9(2)10(12(13,14)15)16-8-6-7-11(3,4)5/h9-10,16H,6-8H2,1-5H3/t10-/m0/s1 |
| InChIKey | YAJKMDWYLHCDPI-JTQLQIEISA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|