About 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine
1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine (PubChem CID 153298849) has the molecular formula C14H28FN3
and a molecular weight of 257.40 g/mol. Its IUPAC name is 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine.
Molecular Properties
| Compound Name | 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine |
| PubChem CID | 153298849 |
| Molecular Formula | C14H28FN3 |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.23 |
| IUPAC Name | 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine |
| SMILES | C[C@@H]1C(CN2CCNCC2)[C@@H](F)CN1C(C)(C)C |
| InChI | InChI=1S/C14H28FN3/c1-11-12(9-17-7-5-16-6-8-17)13(15)10-18(11)14(2,3)4/h11-13,16H,5-10H2,1-4H3/t11-,12?,13+/m1/s1 |
| InChIKey | RUTYGAJWSXSBTD-YPHAAILGSA-N |
| XLogP | 1.35 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine?
The IUPAC name of 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine (CID 153298849) is 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine.
What is the SMILES notation for 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine?
The canonical SMILES for 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine is C[C@@H]1C(CN2CCNCC2)[C@@H](F)CN1C(C)(C)C.
What is the InChIKey of 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine?
The InChIKey is RUTYGAJWSXSBTD-YPHAAILGSA-N. The full InChI is InChI=1S/C14H28FN3/c1-11-12(9-17-7-5-16-6-8-17)13(15)10-18(11)14(2,3)4/h11-13,16H,5-10H2,1-4H3/t11-,12?,13+/m1/s1.
What are the key properties of 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine?
1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine has a molecular weight of 257.40 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2R,4R)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-yl]methyl]piperazine is sourced from PubChem (CID 153298849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).