C26H28N4O2S2 — CID 153298978
2-[4-[[2-[4-(dimethylamino)phenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethyl 2-methylbutanoate (PubChem CID 153298978) has the molecular formula C26H28N4O2S2 and a molecular weight of 492.67 g/mol. Its IUPAC name is 2-[4-[[2-[4-(dimethylamino)phenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethyl 2-methylbutanoate.
| Compound Name | 2-[4-[[2-[4-(dimethylamino)phenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 153298978 |
| Molecular Formula | C26H28N4O2S2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 2-[4-[[2-[4-(dimethylamino)phenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]phenyl]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCc1ccc(/N=N/c2cc3sc(-c4ccc(N(C)C)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C26H28N4O2S2/c1-5-17(2)26(31)32-15-14-18-6-10-20(11-7-18)28-29-23-16-22-25(34-23)27-24(33-22)19-8-12-21(13-9-19)30(3)4/h6-13,16-17H,5,14-15H2,1-4H3/b29-28+ |
| InChIKey | QXKXOQUTNGXFCW-ZQHSETAFSA-N |
| XLogP | 7.64 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|