C66H46O7S2 — CID 153299477
9-(6-but-2-ynoxynaphthalen-2-yl)-9-[4-[4-[9-(6-but-2-ynoxynaphthalen-2-yl)-10,10-dioxothioxanthen-9-yl]phenoxy]phenyl]thioxanthene 10,10-dioxide (PubChem CID 153299477) has the molecular formula C66H46O7S2 and a molecular weight of 1015.22 g/mol. Its IUPAC name is 9-(6-but-2-ynoxynaphthalen-2-yl)-9-[4-[4-[9-(6-but-2-ynoxynaphthalen-2-yl)-10,10-dioxothioxanthen-9-yl]phenoxy]phenyl]thioxanthene 10,10-dioxide.
| Compound Name | 9-(6-but-2-ynoxynaphthalen-2-yl)-9-[4-[4-[9-(6-but-2-ynoxynaphthalen-2-yl)-10,10-dioxothioxanthen-9-yl]phenoxy]phenyl]thioxanthene 10,10-dioxide |
|---|---|
| PubChem CID | 153299477 |
| Molecular Formula | C66H46O7S2 |
| Molecular Weight | 1015.22 g/mol |
| Exact Mass | 1014.27 |
| IUPAC Name | 9-(6-but-2-ynoxynaphthalen-2-yl)-9-[4-[4-[9-(6-but-2-ynoxynaphthalen-2-yl)-10,10-dioxothioxanthen-9-yl]phenoxy]phenyl]thioxanthene 10,10-dioxide |
| SMILES | CC#CCOc1ccc2cc(C3(c4ccc(Oc5ccc(C6(c7ccc8cc(OCC#CC)ccc8c7)c7ccccc7S(=O)(=O)c7ccccc76)cc5)cc4)c4ccccc4S(=O)(=O)c4ccccc43)ccc2c1 |
| InChI | InChI=1S/C66H46O7S2/c1-3-5-39-71-55-33-25-45-41-51(27-23-47(45)43-55)65(57-15-7-11-19-61(57)74(67,68)62-20-12-8-16-58(62)65)49-29-35-53(36-30-49)73-54-37-31-50(32-38-54)66(52-28-24-48-44-56(72-40-6-4-2)34-26-46(48)42-52)59-17-9-13-21-63(59)75(69,70)64-22-14-10-18-60(64)66/h7-38,41-44H,39-40H2,1-2H3 |
| InChIKey | SHWPHZWHBZWVCG-UHFFFAOYSA-N |
| XLogP | 13.65 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.22 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|