About 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea
1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea (PubChem CID 153299914) has the molecular formula C18H33ClN4O2
and a molecular weight of 372.94 g/mol. Its IUPAC name is 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea.
Molecular Properties
| Compound Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea |
| PubChem CID | 153299914 |
| Molecular Formula | C18H33ClN4O2 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea |
| SMILES | CC1CC(Cl)NC(NC(=O)NC2CCCC(OC3CCCCC3)C2)N1 |
| InChI | InChI=1S/C18H33ClN4O2/c1-12-10-16(19)22-17(20-12)23-18(24)21-13-6-5-9-15(11-13)25-14-7-3-2-4-8-14/h12-17,20,22H,2-11H2,1H3,(H2,21,23,24) |
| InChIKey | YBAORPVHLCSVKK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea?
The IUPAC name of 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea (CID 153299914) is 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea.
What is the SMILES notation for 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea?
The canonical SMILES for 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea is CC1CC(Cl)NC(NC(=O)NC2CCCC(OC3CCCCC3)C2)N1.
What is the InChIKey of 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea?
The InChIKey is YBAORPVHLCSVKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33ClN4O2/c1-12-10-16(19)22-17(20-12)23-18(24)21-13-6-5-9-15(11-13)25-14-7-3-2-4-8-14/h12-17,20,22H,2-11H2,1H3,(H2,21,23,24).
What are the key properties of 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea?
1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea has a molecular weight of 372.94 g/mol, XLogP of 2.77, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-cyclohexyloxycyclohexyl)urea is sourced from PubChem (CID 153299914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).