C40H41F2N3O12S2 — CID 153301231
2-[2-[2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 153301231) has the molecular formula C40H41F2N3O12S2 and a molecular weight of 857.91 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 153301231 |
| Molecular Formula | C40H41F2N3O12S2 |
| Molecular Weight | 857.91 g/mol |
| Exact Mass | 857.21 |
| IUPAC Name | 2-[2-[2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCOCCOc1c(F)cc(N2C(=O)C(Sc3ccc(C(=O)N4CCOCC4)cc3)=C(Sc3ccc(C(=O)N4CCOCC4)cc3)C2=O)cc1F |
| InChI | InChI=1S/C40H41F2N3O12S2/c41-31-23-28(24-32(42)34(31)57-22-21-55-18-17-54-19-20-56-25-33(46)47)45-39(50)35(58-29-5-1-26(2-6-29)37(48)43-9-13-52-14-10-43)36(40(45)51)59-30-7-3-27(4-8-30)38(49)44-11-15-53-16-12-44/h1-8,23-24H,9-22,25H2,(H,46,47) |
| InChIKey | WXCDVBBAYBLRSJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 170.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.91 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|