C41H42F3N3O12S2 — CID 153301232
2-[2-[2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-3-(trifluoromethyl)phenoxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 153301232) has the molecular formula C41H42F3N3O12S2 and a molecular weight of 889.92 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-3-(trifluoromethyl)phenoxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-3-(trifluoromethyl)phenoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 153301232 |
| Molecular Formula | C41H42F3N3O12S2 |
| Molecular Weight | 889.92 g/mol |
| Exact Mass | 889.22 |
| IUPAC Name | 2-[2-[2-[2-[4-[3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-3-(trifluoromethyl)phenoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCOCCOc1ccc(N2C(=O)C(Sc3ccc(C(=O)N4CCOCC4)cc3)=C(Sc3ccc(C(=O)N4CCOCC4)cc3)C2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C41H42F3N3O12S2/c42-41(43,44)32-25-29(59-24-23-57-20-19-56-21-22-58-26-34(48)49)5-10-33(32)47-39(52)35(60-30-6-1-27(2-7-30)37(50)45-11-15-54-16-12-45)36(40(47)53)61-31-8-3-28(4-9-31)38(51)46-13-17-55-18-14-46/h1-10,25H,11-24,26H2,(H,48,49) |
| InChIKey | WPIHBXQKDLDTKL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 170.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.92 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|