C34H33F2N3O10S2 — CID 153301239
2-[2-[2-[2-[4-[3,4-bis[[4-(methylcarbamoyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 153301239) has the molecular formula C34H33F2N3O10S2 and a molecular weight of 745.78 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-[3,4-bis[[4-(methylcarbamoyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[4-[3,4-bis[[4-(methylcarbamoyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 153301239 |
| Molecular Formula | C34H33F2N3O10S2 |
| Molecular Weight | 745.78 g/mol |
| Exact Mass | 745.16 |
| IUPAC Name | 2-[2-[2-[2-[4-[3,4-bis[[4-(methylcarbamoyl)phenyl]sulfanyl]-2,5-dioxopyrrol-1-yl]-2,6-difluorophenoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CNC(=O)c1ccc(SC2=C(Sc3ccc(C(=O)NC)cc3)C(=O)N(c3cc(F)c(OCCOCCOCCOCC(=O)O)c(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C34H33F2N3O10S2/c1-37-31(42)20-3-7-23(8-4-20)50-29-30(51-24-9-5-21(6-10-24)32(43)38-2)34(45)39(33(29)44)22-17-25(35)28(26(36)18-22)49-16-15-47-12-11-46-13-14-48-19-27(40)41/h3-10,17-18H,11-16,19H2,1-2H3,(H,37,42)(H,38,43)(H,40,41) |
| InChIKey | KYGWHVDZQQMSLG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 169.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.78 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|