About 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one
6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one (PubChem CID 153301418) has the molecular formula C11H12FNO
and a molecular weight of 193.22 g/mol. Its IUPAC name is 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one |
| PubChem CID | 153301418 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one |
| SMILES | CC(C)c1cc2c(cc1F)C(=O)NC2 |
| InChI | InChI=1S/C11H12FNO/c1-6(2)8-3-7-5-13-11(14)9(7)4-10(8)12/h3-4,6H,5H2,1-2H3,(H,13,14) |
| InChIKey | MTSDBFALMCICGW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one?
The IUPAC name of 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one (CID 153301418) is 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one?
The canonical SMILES for 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one is CC(C)c1cc2c(cc1F)C(=O)NC2.
What is the InChIKey of 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one?
The InChIKey is MTSDBFALMCICGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO/c1-6(2)8-3-7-5-13-11(14)9(7)4-10(8)12/h3-4,6H,5H2,1-2H3,(H,13,14).
What are the key properties of 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one?
6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one has a molecular weight of 193.22 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-5-propan-2-yl-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 153301418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).