C53H27F3N6 — CID 153302781
2-[4,5-bis[3-(4-cyanophenyl)carbazol-9-yl]-2-isocyanophenyl]-5-(trifluoromethyl)benzonitrile (PubChem CID 153302781) has the molecular formula C53H27F3N6 and a molecular weight of 804.83 g/mol. Its IUPAC name is 2-[4,5-bis[3-(4-cyanophenyl)carbazol-9-yl]-2-isocyanophenyl]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[4,5-bis[3-(4-cyanophenyl)carbazol-9-yl]-2-isocyanophenyl]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 153302781 |
| Molecular Formula | C53H27F3N6 |
| Molecular Weight | 804.83 g/mol |
| Exact Mass | 804.22 |
| IUPAC Name | 2-[4,5-bis[3-(4-cyanophenyl)carbazol-9-yl]-2-isocyanophenyl]-5-(trifluoromethyl)benzonitrile |
| SMILES | [C-]#[N+]c1cc(-n2c3ccccc3c3cc(-c4ccc(C#N)cc4)ccc32)c(-n2c3ccccc3c3cc(-c4ccc(C#N)cc4)ccc32)cc1-c1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C53H27F3N6/c1-60-46-28-52(62-48-9-5-3-7-42(48)45-26-37(19-23-50(45)62)35-16-12-33(30-58)13-17-35)51(27-43(46)40-21-20-39(53(54,55)56)24-38(40)31-59)61-47-8-4-2-6-41(47)44-25-36(18-22-49(44)61)34-14-10-32(29-57)11-15-34/h2-28H |
| InChIKey | YWWDXUXYMDYQJS-UHFFFAOYSA-N |
| XLogP | 14.07 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.83 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|