C59H55N4OPt- — CID 153304231
2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(5-pyridin-2-yl-2-pyridinyl)benzene-6-id-1-yl]-1-(2,4-diphenylphenyl)benzimidazol-2-yl]phenol;platinum (PubChem CID 153304231) has the molecular formula C59H55N4OPt- and a molecular weight of 1031.19 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(5-pyridin-2-yl-2-pyridinyl)benzene-6-id-1-yl]-1-(2,4-diphenylphenyl)benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(5-pyridin-2-yl-2-pyridinyl)benzene-6-id-1-yl]-1-(2,4-diphenylphenyl)benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153304231 |
| Molecular Formula | C59H55N4OPt- |
| Molecular Weight | 1031.19 g/mol |
| Exact Mass | 1030.40 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-[3-tert-butyl-5-(5-pyridin-2-yl-2-pyridinyl)benzene-6-id-1-yl]-1-(2,4-diphenylphenyl)benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2ccc(-c3ccccn3)cn2)[c-]c(-c2cccc3c2nc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)n3-c2ccc(-c3ccccc3)cc2-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C59H55N4O.Pt/c1-57(2,3)44-32-42(31-43(33-44)51-28-26-41(37-61-51)50-24-16-17-30-60-50)46-23-18-25-53-54(46)62-56(48-35-45(58(4,5)6)36-49(55(48)64)59(7,8)9)63(53)52-29-27-40(38-19-12-10-13-20-38)34-47(52)39-21-14-11-15-22-39;/h10-30,32-37,64H,1-9H3;/q-1; |
| InChIKey | FHKINHWSUSFTGW-UHFFFAOYSA-N |
| XLogP | 15.21 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.19 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|