C27H21F9O8S — CID 153306073
[3-[[1,1-difluoro-3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]sulfanylpropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate (PubChem CID 153306073) has the molecular formula C27H21F9O8S and a molecular weight of 676.51 g/mol. Its IUPAC name is [3-[[1,1-difluoro-3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]sulfanylpropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate.
| Compound Name | [3-[[1,1-difluoro-3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]sulfanylpropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate |
|---|---|
| PubChem CID | 153306073 |
| Molecular Formula | C27H21F9O8S |
| Molecular Weight | 676.51 g/mol |
| Exact Mass | 676.08 |
| IUPAC Name | [3-[[1,1-difluoro-3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]sulfanylpropoxy]-difluoromethoxy]-3,3-difluoropropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)OC(F)(F)OC(F)(F)CCSc1ccc2cc(-c3ccc(OC)cc3OC(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C27H21F9O8S/c1-3-22(37)40-10-8-24(28,29)43-27(35,36)44-25(30,31)9-11-45-17-6-4-15-12-19(23(38)41-20(15)14-17)18-7-5-16(39-2)13-21(18)42-26(32,33)34/h3-7,12-14H,1,8-11H2,2H3 |
| InChIKey | JMDYMFYJXILLMN-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.51 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|