C29H25F9O5S — CID 153306081
[2,2,3,3,4,4-hexafluoro-5-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylpentyl] prop-2-enoate (PubChem CID 153306081) has the molecular formula C29H25F9O5S and a molecular weight of 656.56 g/mol. Its IUPAC name is [2,2,3,3,4,4-hexafluoro-5-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylpentyl] prop-2-enoate.
| Compound Name | [2,2,3,3,4,4-hexafluoro-5-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylpentyl] prop-2-enoate |
|---|---|
| PubChem CID | 153306081 |
| Molecular Formula | C29H25F9O5S |
| Molecular Weight | 656.56 g/mol |
| Exact Mass | 656.13 |
| IUPAC Name | [2,2,3,3,4,4-hexafluoro-5-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylpentyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)CSc1ccc2cc(-c3ccc(CCCCC)cc3OC(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C29H25F9O5S/c1-3-5-6-7-17-8-11-20(23(12-17)43-29(36,37)38)21-13-18-9-10-19(14-22(18)42-25(21)40)44-16-27(32,33)28(34,35)26(30,31)15-41-24(39)4-2/h4,8-14H,2-3,5-7,15-16H2,1H3 |
| InChIKey | FGKRKZHPZQTQPI-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.56 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|