About N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine
N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine (PubChem CID 153306520) has the molecular formula C12H22F3N
and a molecular weight of 237.31 g/mol. Its IUPAC name is N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine.
Molecular Properties
| Compound Name | N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine |
| PubChem CID | 153306520 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine |
| SMILES | CCCCN(C1CC1)[C@@H](C(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H22F3N/c1-4-5-8-16(10-6-7-10)11(9(2)3)12(13,14)15/h9-11H,4-8H2,1-3H3/t11-/m0/s1 |
| InChIKey | RNYCNHHSDYTLSQ-NSHDSACASA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine?
The IUPAC name of N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine (CID 153306520) is N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine.
What is the SMILES notation for N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine?
The canonical SMILES for N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine is CCCCN(C1CC1)[C@@H](C(C)C)C(F)(F)F.
What is the InChIKey of N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine?
The InChIKey is RNYCNHHSDYTLSQ-NSHDSACASA-N. The full InChI is InChI=1S/C12H22F3N/c1-4-5-8-16(10-6-7-10)11(9(2)3)12(13,14)15/h9-11H,4-8H2,1-3H3/t11-/m0/s1.
What are the key properties of N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine?
N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine has a molecular weight of 237.31 g/mol, XLogP of 3.84, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-[(2S)-1,1,1-trifluoro-3-methylbutan-2-yl]cyclopropanamine is sourced from PubChem (CID 153306520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).