C15H29NO2 — CID 153306524
N-[(Z)-5-(2,2-dimethylpropoxy)pent-3-enyl]-2,2-dimethylpropanamide (PubChem CID 153306524) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is N-[(Z)-5-(2,2-dimethylpropoxy)pent-3-enyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(Z)-5-(2,2-dimethylpropoxy)pent-3-enyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 153306524 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | N-[(Z)-5-(2,2-dimethylpropoxy)pent-3-enyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)COC/C=C\CCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H29NO2/c1-14(2,3)12-18-11-9-7-8-10-16-13(17)15(4,5)6/h7,9H,8,10-12H2,1-6H3,(H,16,17)/b9-7- |
| InChIKey | SSKVLVDJIDHLNJ-CLFYSBASSA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|