C26H29BrN6O5 — CID 153306605
(4S,6R,8R,21Z)-14-acetyl-29-bromo-6-methyl-24-oxa-2,9,12,13,18,30-hexazapentacyclo[24.4.0.04,9.06,8.012,16]triaconta-1(26),13,15,21,27,29-hexaene-3,10,17-trione (PubChem CID 153306605) has the molecular formula C26H29BrN6O5 and a molecular weight of 585.46 g/mol. Its IUPAC name is (4S,6R,8R,21Z)-14-acetyl-29-bromo-6-methyl-24-oxa-2,9,12,13,18,30-hexazapentacyclo[24.4.0.04,9.06,8.012,16]triaconta-1(26),13,15,21,27,29-hexaene-3,10,17-trione.
| Compound Name | (4S,6R,8R,21Z)-14-acetyl-29-bromo-6-methyl-24-oxa-2,9,12,13,18,30-hexazapentacyclo[24.4.0.04,9.06,8.012,16]triaconta-1(26),13,15,21,27,29-hexaene-3,10,17-trione |
|---|---|
| PubChem CID | 153306605 |
| Molecular Formula | C26H29BrN6O5 |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | (4S,6R,8R,21Z)-14-acetyl-29-bromo-6-methyl-24-oxa-2,9,12,13,18,30-hexazapentacyclo[24.4.0.04,9.06,8.012,16]triaconta-1(26),13,15,21,27,29-hexaene-3,10,17-trione |
| SMILES | CC(=O)c1cc2n(n1)CC(=O)N1[C@@H](C[C@@]3(C)C[C@@H]13)C(=O)Nc1nc(Br)ccc1COC/C=C\CCNC2=O |
| InChI | InChI=1S/C26H29BrN6O5/c1-15(34)17-10-18-24(36)28-8-4-3-5-9-38-14-16-6-7-21(27)29-23(16)30-25(37)19-11-26(2)12-20(26)33(19)22(35)13-32(18)31-17/h3,5-7,10,19-20H,4,8-9,11-14H2,1-2H3,(H,28,36)(H,29,30,37)/b5-3-/t19-,20+,26-/m0/s1 |
| InChIKey | ALBVVJRCGKHXBZ-RVJMGQPSSA-N |
| XLogP | 2.47 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|