C15H31F2NO — CID 153306615
N-[3-(2,2-dimethylpropoxy)-2,2-difluoropropyl]-4,4-dimethylpentan-1-amine (PubChem CID 153306615) has the molecular formula C15H31F2NO and a molecular weight of 279.42 g/mol. Its IUPAC name is N-[3-(2,2-dimethylpropoxy)-2,2-difluoropropyl]-4,4-dimethylpentan-1-amine.
| Compound Name | N-[3-(2,2-dimethylpropoxy)-2,2-difluoropropyl]-4,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 153306615 |
| Molecular Formula | C15H31F2NO |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | N-[3-(2,2-dimethylpropoxy)-2,2-difluoropropyl]-4,4-dimethylpentan-1-amine |
| SMILES | CC(C)(C)CCCNCC(F)(F)COCC(C)(C)C |
| InChI | InChI=1S/C15H31F2NO/c1-13(2,3)8-7-9-18-10-15(16,17)12-19-11-14(4,5)6/h18H,7-12H2,1-6H3 |
| InChIKey | UJTWXWZWRSKRSU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|