C16H29F2NO2 — CID 153306623
(E)-6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-difluorohex-4-enamide (PubChem CID 153306623) has the molecular formula C16H29F2NO2 and a molecular weight of 305.41 g/mol. Its IUPAC name is (E)-6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-difluorohex-4-enamide.
| Compound Name | (E)-6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-difluorohex-4-enamide |
|---|---|
| PubChem CID | 153306623 |
| Molecular Formula | C16H29F2NO2 |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (E)-6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-difluorohex-4-enamide |
| SMILES | CC(C)(C)CNC(=O)C(F)(F)C/C=C/COCC(C)(C)C |
| InChI | InChI=1S/C16H29F2NO2/c1-14(2,3)11-19-13(20)16(17,18)9-7-8-10-21-12-15(4,5)6/h7-8H,9-12H2,1-6H3,(H,19,20)/b8-7+ |
| InChIKey | OOYCLHSBLYUTHX-BQYQJAHWSA-N |
| XLogP | 3.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|