C35H39BrFN7O4 — CID 153306863
(1S,20R)-22-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-20-fluoro-18-oxa-3,5,22-triazatricyclo[18.2.1.04,9]tricosa-4(9),5,7-trien-2-one (PubChem CID 153306863) has the molecular formula C35H39BrFN7O4 and a molecular weight of 720.64 g/mol. Its IUPAC name is (1S,20R)-22-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-20-fluoro-18-oxa-3,5,22-triazatricyclo[18.2.1.04,9]tricosa-4(9),5,7-trien-2-one.
| Compound Name | (1S,20R)-22-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-20-fluoro-18-oxa-3,5,22-triazatricyclo[18.2.1.04,9]tricosa-4(9),5,7-trien-2-one |
|---|---|
| PubChem CID | 153306863 |
| Molecular Formula | C35H39BrFN7O4 |
| Molecular Weight | 720.64 g/mol |
| Exact Mass | 719.22 |
| IUPAC Name | (1S,20R)-22-[2-[3-acetyl-5-(2-methylpyrimidin-5-yl)indazol-1-yl]acetyl]-6-bromo-20-fluoro-18-oxa-3,5,22-triazatricyclo[18.2.1.04,9]tricosa-4(9),5,7-trien-2-one |
| SMILES | CC(=O)c1nn(CC(=O)N2C[C@@]3(F)COCCCCCCCCc4ccc(Br)nc4NC(=O)[C@@H]2C3)c2ccc(-c3cnc(C)nc3)cc12 |
| InChI | InChI=1S/C35H39BrFN7O4/c1-22(45)32-27-15-25(26-17-38-23(2)39-18-26)10-12-28(27)44(42-32)19-31(46)43-20-35(37)16-29(43)34(47)41-33-24(11-13-30(36)40-33)9-7-5-3-4-6-8-14-48-21-35/h10-13,15,17-18,29H,3-9,14,16,19-21H2,1-2H3,(H,40,41,47)/t29-,35+/m0/s1 |
| InChIKey | KRXDDZWYONGXHG-WHMAPKLYSA-N |
| XLogP | 6.02 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|