C78H84N4 — CID 153306944
4-(3,6-ditert-butylcarbazol-9-yl)-N,N-bis[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]aniline (PubChem CID 153306944) has the molecular formula C78H84N4 and a molecular weight of 1077.56 g/mol. Its IUPAC name is 4-(3,6-ditert-butylcarbazol-9-yl)-N,N-bis[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]aniline.
| Compound Name | 4-(3,6-ditert-butylcarbazol-9-yl)-N,N-bis[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]aniline |
|---|---|
| PubChem CID | 153306944 |
| Molecular Formula | C78H84N4 |
| Molecular Weight | 1077.56 g/mol |
| Exact Mass | 1076.67 |
| IUPAC Name | 4-(3,6-ditert-butylcarbazol-9-yl)-N,N-bis[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]aniline |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(N(c2ccc(-n3c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)ccc43)cc2)c2ccc(-n3c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)ccc43)cc2)cc1 |
| InChI | InChI=1S/C78H84N4/c1-73(2,3)49-19-37-67-61(43-49)62-44-50(74(4,5)6)20-38-68(62)80(67)58-31-25-55(26-32-58)79(56-27-33-59(34-28-56)81-69-39-21-51(75(7,8)9)45-63(69)64-46-52(76(10,11)12)22-40-70(64)81)57-29-35-60(36-30-57)82-71-41-23-53(77(13,14)15)47-65(71)66-48-54(78(16,17)18)24-42-72(66)82/h19-48H,1-18H3 |
| InChIKey | SAECTFBERDVOOW-UHFFFAOYSA-N |
| XLogP | 22.23 |
| TPSA | 18.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1077.56 |
| LogP ≤ 5 | 22.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |