C60H53N — CID 153307449
2',7'-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-(4-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine (PubChem CID 153307449) has the molecular formula C60H53N and a molecular weight of 788.09 g/mol. Its IUPAC name is 2',7'-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-(4-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine.
| Compound Name | 2',7'-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-(4-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine |
|---|---|
| PubChem CID | 153307449 |
| Molecular Formula | C60H53N |
| Molecular Weight | 788.09 g/mol |
| Exact Mass | 787.42 |
| IUPAC Name | 2',7'-ditert-butyl-N-(9,9-dimethylfluoren-2-yl)-N-(4-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3cc(C(C)(C)C)ccc3-2)c2ccccc2-c2c(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cccc21 |
| InChI | InChI=1S/C60H53N/c1-57(2,3)40-27-32-46-47-33-28-41(58(4,5)6)36-54(47)60(53(46)35-40)50-22-15-13-20-48(50)56-51(60)23-16-24-55(56)61(42-29-25-39(26-30-42)38-17-10-9-11-18-38)43-31-34-45-44-19-12-14-21-49(44)59(7,8)52(45)37-43/h9-37H,1-8H3 |
| InChIKey | PEAAKMUKFNTEKX-UHFFFAOYSA-N |
| XLogP | 16.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.09 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |