C14H24O3Si — CID 153307550
[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]-triethoxysilane (PubChem CID 153307550) has the molecular formula C14H24O3Si and a molecular weight of 268.43 g/mol. Its IUPAC name is [(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]-triethoxysilane.
| Compound Name | [(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]-triethoxysilane |
|---|---|
| PubChem CID | 153307550 |
| Molecular Formula | C14H24O3Si |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]-triethoxysilane |
| SMILES | CCO[Si](OCC)(OCC)/C1=C/C=C\C=C/CC1 |
| InChI | InChI=1S/C14H24O3Si/c1-4-15-18(16-5-2,17-6-3)14-12-10-8-7-9-11-13-14/h7-10,12H,4-6,11,13H2,1-3H3/b9-7-,10-8-,14-12+ |
| InChIKey | LIFJIYOBSSWRCS-ZTPPHAPOSA-N |
| XLogP | 3.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|