About 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one
4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one (PubChem CID 153309025) has the molecular formula C16H14F2N2O
and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one |
| PubChem CID | 153309025 |
| Molecular Formula | C16H14F2N2O |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(c2ccc(F)c(F)c2)CN1Cc1ccncc1 |
| InChI | InChI=1S/C16H14F2N2O/c17-14-2-1-12(7-15(14)18)13-8-16(21)20(10-13)9-11-3-5-19-6-4-11/h1-7,13H,8-10H2 |
| InChIKey | BPRHHTOIWVIPEF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one?
The IUPAC name of 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one (CID 153309025) is 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one.
What is the SMILES notation for 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one?
The canonical SMILES for 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one is O=C1CC(c2ccc(F)c(F)c2)CN1Cc1ccncc1.
What is the InChIKey of 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one?
The InChIKey is BPRHHTOIWVIPEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F2N2O/c17-14-2-1-12(7-15(14)18)13-8-16(21)20(10-13)9-11-3-5-19-6-4-11/h1-7,13H,8-10H2.
What are the key properties of 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one?
4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one has a molecular weight of 288.30 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluorophenyl)-1-(pyridin-4-ylmethyl)pyrrolidin-2-one is sourced from PubChem (CID 153309025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).