C49H30N5OS+ — CID 153309354
2-[3-[9-(3,5-diphenyl-1,2,4-triazin-1-ium-1-yl)dibenzofuran-3-yl]phenyl]-4-phenyl-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 153309354) has the molecular formula C49H30N5OS+ and a molecular weight of 736.88 g/mol. Its IUPAC name is 2-[3-[9-(3,5-diphenyl-1,2,4-triazin-1-ium-1-yl)dibenzofuran-3-yl]phenyl]-4-phenyl-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2-[3-[9-(3,5-diphenyl-1,2,4-triazin-1-ium-1-yl)dibenzofuran-3-yl]phenyl]-4-phenyl-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 153309354 |
| Molecular Formula | C49H30N5OS+ |
| Molecular Weight | 736.88 g/mol |
| Exact Mass | 736.22 |
| IUPAC Name | 2-[3-[9-(3,5-diphenyl-1,2,4-triazin-1-ium-1-yl)dibenzofuran-3-yl]phenyl]-4-phenyl-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | c1ccc(-c2c[n+](-c3cccc4oc5cc(-c6cccc(-c7nc(-c8ccccc8)c8sc9ccccc9c8n7)c6)ccc5c34)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C49H30N5OS/c1-4-14-31(15-5-1)39-30-54(53-49(50-39)33-18-8-3-9-19-33)40-23-13-24-41-44(40)37-27-26-35(29-42(37)55-41)34-20-12-21-36(28-34)48-51-45(32-16-6-2-7-17-32)47-46(52-48)38-22-10-11-25-43(38)56-47/h1-30H/q+1 |
| InChIKey | IPKLOCRKAOVMLF-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 68.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.88 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|