C32H26NaO4P — CID 153309754
sodium bis[(2E)-2-tricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaenyl] phosphate (PubChem CID 153309754) has the molecular formula C32H26NaO4P and a molecular weight of 528.52 g/mol. Its IUPAC name is sodium bis[(2E)-2-tricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaenyl] phosphate.
| Compound Name | sodium bis[(2E)-2-tricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaenyl] phosphate |
|---|---|
| PubChem CID | 153309754 |
| Molecular Formula | C32H26NaO4P |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | sodium bis[(2E)-2-tricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,12,14-heptaenyl] phosphate |
| SMILES | O=P([O-])(O/C1=C/c2ccccc2CCc2ccccc21)O/C1=C/c2ccccc2CCc2ccccc21.[Na+] |
| InChI | InChI=1S/C32H27O4P.Na/c33-37(34,35-31-21-27-13-3-1-9-23(27)17-19-25-11-5-7-15-29(25)31)36-32-22-28-14-4-2-10-24(28)18-20-26-12-6-8-16-30(26)32;/h1-16,21-22H,17-20H2,(H,33,34);/q;+1/p-1/b31-21+,32-22+; |
| InChIKey | XWYICCLMCCIPCU-XGUYBVJSSA-M |
| XLogP | 4.09 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|