C39H27N3O — CID 153310061
6-[4-[2-[(3Z)-hexa-1,3,5-trien-2-yl]-6-(4-phenylphenyl)pyrimidin-4-yl]naphthalen-1-yl]-1,3-benzoxazole (PubChem CID 153310061) has the molecular formula C39H27N3O and a molecular weight of 553.67 g/mol. Its IUPAC name is 6-[4-[2-[(3Z)-hexa-1,3,5-trien-2-yl]-6-(4-phenylphenyl)pyrimidin-4-yl]naphthalen-1-yl]-1,3-benzoxazole.
| Compound Name | 6-[4-[2-[(3Z)-hexa-1,3,5-trien-2-yl]-6-(4-phenylphenyl)pyrimidin-4-yl]naphthalen-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 153310061 |
| Molecular Formula | C39H27N3O |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 6-[4-[2-[(3Z)-hexa-1,3,5-trien-2-yl]-6-(4-phenylphenyl)pyrimidin-4-yl]naphthalen-1-yl]-1,3-benzoxazole |
| SMILES | C=C/C=C\C(=C)c1nc(-c2ccc(-c3ccccc3)cc2)cc(-c2ccc(-c3ccc4ncoc4c3)c3ccccc23)n1 |
| InChI | InChI=1S/C39H27N3O/c1-3-4-10-26(2)39-41-36(29-17-15-28(16-18-29)27-11-6-5-7-12-27)24-37(42-39)34-21-20-31(32-13-8-9-14-33(32)34)30-19-22-35-38(23-30)43-25-40-35/h3-25H,1-2H2/b10-4- |
| InChIKey | DHGKDPIABRCRBQ-WMZJFQQLSA-N |
| XLogP | 10.19 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|