C11H12O4 — CID 15331011
(1S,3S,4R)-4-hydroxy-1,3-dimethyl-3,4-dihydro-1H-isochromene-5,8-dione (PubChem CID 15331011) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is (1S,3S,4R)-4-hydroxy-1,3-dimethyl-3,4-dihydro-1H-isochromene-5,8-dione.
| Compound Name | (1S,3S,4R)-4-hydroxy-1,3-dimethyl-3,4-dihydro-1H-isochromene-5,8-dione |
|---|---|
| PubChem CID | 15331011 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (1S,3S,4R)-4-hydroxy-1,3-dimethyl-3,4-dihydro-1H-isochromene-5,8-dione |
| SMILES | C[C@@H]1O[C@@H](C)[C@H](O)C2=C1C(=O)C=CC2=O |
| InChI | InChI=1S/C11H12O4/c1-5-9-7(12)3-4-8(13)10(9)11(14)6(2)15-5/h3-6,11,14H,1-2H3/t5-,6-,11-/m0/s1 |
| InChIKey | HSIIBIYKFWINAF-BVMVBECYSA-N |
| XLogP | 0.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|