C17H35NS — CID 153310497
4,5,6,7-tetra(propan-2-yl)-1,4-thiazepane (PubChem CID 153310497) has the molecular formula C17H35NS and a molecular weight of 285.54 g/mol. Its IUPAC name is 4,5,6,7-tetra(propan-2-yl)-1,4-thiazepane.
| Compound Name | 4,5,6,7-tetra(propan-2-yl)-1,4-thiazepane |
|---|---|
| PubChem CID | 153310497 |
| Molecular Formula | C17H35NS |
| Molecular Weight | 285.54 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 4,5,6,7-tetra(propan-2-yl)-1,4-thiazepane |
| SMILES | CC(C)C1SCCN(C(C)C)C(C(C)C)C1C(C)C |
| InChI | InChI=1S/C17H35NS/c1-11(2)15-16(12(3)4)18(14(7)8)9-10-19-17(15)13(5)6/h11-17H,9-10H2,1-8H3 |
| InChIKey | PYJGHQLJTLKJSV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |