About 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline
10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline (PubChem CID 153310513) has the molecular formula C15H17NO2Si
and a molecular weight of 271.39 g/mol. Its IUPAC name is 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline.
Molecular Properties
| Compound Name | 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline |
| PubChem CID | 153310513 |
| Molecular Formula | C15H17NO2Si |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline |
| SMILES | CC(C)N1c2ccccc2[Si](O)(O)c2ccccc21 |
| InChI | InChI=1S/C15H17NO2Si/c1-11(2)16-12-7-3-5-9-14(12)19(17,18)15-10-6-4-8-13(15)16/h3-11,17-18H,1-2H3 |
| InChIKey | BCQLEZBXDFYZHJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline?
The IUPAC name of 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline (CID 153310513) is 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline.
What is the SMILES notation for 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline?
The canonical SMILES for 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline is CC(C)N1c2ccccc2[Si](O)(O)c2ccccc21.
What is the InChIKey of 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline?
The InChIKey is BCQLEZBXDFYZHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2Si/c1-11(2)16-12-7-3-5-9-14(12)19(17,18)15-10-6-4-8-13(15)16/h3-11,17-18H,1-2H3.
What are the key properties of 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline?
10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline has a molecular weight of 271.39 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-dihydroxy-5-propan-2-ylbenzo[b][1,4]benzazasiline is sourced from PubChem (CID 153310513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).