About CID 153310558
CID 153310558 (PubChem CID 153310558) has the molecular formula C62H58IrN5O2
and a molecular weight of 1097.40 g/mol.
Molecular Properties
| Compound Name | CID 153310558 |
| PubChem CID | 153310558 |
| Molecular Formula | C62H58IrN5O2 |
| Molecular Weight | 1097.40 g/mol |
| Exact Mass | 1097.42 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(n1)oc1c3[c-]cc(c12)CCCCCCc1ccc(nc1)-c1[c-]cc(c2c1oc1ncccc12)CCCCCCc1ccc(nc1)-c1[c-]cc(cc1)CCCCCCc1ccc-3nc1.[Ir+3] |
| InChI | InChI=1S/C62H58N5O2.Ir/c1-42-22-32-53-58-49-20-13-7-5-11-18-46-26-36-55(65-40-46)50-33-30-48(57-52-21-14-38-63-61(52)68-59(50)57)19-12-6-4-10-16-44-25-35-54(64-39-44)47-28-23-43(24-29-47)15-8-2-3-9-17-45-27-37-56(66-41-45)51(34-31-49)60(58)69-62(53)67-42;/h14,21-28,30-32,35-41H,2-13,15-20H2,1H3;/q-3;+3 |
| InChIKey | NENIBCRHZFFMLX-UHFFFAOYSA-N |
| XLogP | 15.52 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 70 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1097.40 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 153310558 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153310558?
The IUPAC name of CID 153310558 (CID 153310558) is not available.
What is the SMILES notation for CID 153310558?
The canonical SMILES for CID 153310558 is Cc1ccc2c(n1)oc1c3[c-]cc(c12)CCCCCCc1ccc(nc1)-c1[c-]cc(c2c1oc1ncccc12)CCCCCCc1ccc(nc1)-c1[c-]cc(cc1)CCCCCCc1ccc-3nc1.[Ir+3].
What is the InChIKey of CID 153310558?
The InChIKey is NENIBCRHZFFMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C62H58N5O2.Ir/c1-42-22-32-53-58-49-20-13-7-5-11-18-46-26-36-55(65-40-46)50-33-30-48(57-52-21-14-38-63-61(52)68-59(50)57)19-12-6-4-10-16-44-25-35-54(64-39-44)47-28-23-43(24-29-47)15-8-2-3-9-17-45-27-37-56(66-41-45)51(34-31-49)60(58)69-62(53)67-42;/h14,21-28,30-32,35-41H,2-13,15-20H2,1H3;/q-3;+3.
What are the key properties of CID 153310558?
CID 153310558 has a molecular weight of 1097.40 g/mol, XLogP of 15.52, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153310558 is sourced from PubChem (CID 153310558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).