C23H26ClN3OS — CID 153311019
6-chloro-3-methyl-N-[2-[4-(1-methylpiperidin-4-yl)phenyl]ethyl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 153311019) has the molecular formula C23H26ClN3OS and a molecular weight of 428.00 g/mol. Its IUPAC name is 6-chloro-3-methyl-N-[2-[4-(1-methylpiperidin-4-yl)phenyl]ethyl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-chloro-3-methyl-N-[2-[4-(1-methylpiperidin-4-yl)phenyl]ethyl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 153311019 |
| Molecular Formula | C23H26ClN3OS |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 6-chloro-3-methyl-N-[2-[4-(1-methylpiperidin-4-yl)phenyl]ethyl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCc2ccc(C3CCN(C)CC3)cc2)sc2nc(Cl)ccc12 |
| InChI | InChI=1S/C23H26ClN3OS/c1-15-19-7-8-20(24)26-23(19)29-21(15)22(28)25-12-9-16-3-5-17(6-4-16)18-10-13-27(2)14-11-18/h3-8,18H,9-14H2,1-2H3,(H,25,28) |
| InChIKey | KDLUVEOZAZRKHT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|