C23H27N5OS — CID 153311049
N-[2-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]phenyl]ethyl]-3-amino-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 153311049) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is N-[2-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]phenyl]ethyl]-3-amino-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-[2-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]phenyl]ethyl]-3-amino-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 153311049 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-[2-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]phenyl]ethyl]-3-amino-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc2c(N)c(C(=O)NCCc3ccc(N4C[C@H]5CNC[C@H]5C4)cc3)sc2n1 |
| InChI | InChI=1S/C23H27N5OS/c1-14-2-7-19-20(24)21(30-23(19)27-14)22(29)26-9-8-15-3-5-18(6-4-15)28-12-16-10-25-11-17(16)13-28/h2-7,16-17,25H,8-13,24H2,1H3,(H,26,29)/t16-,17+ |
| InChIKey | IWEJTEIEYIUJGO-CALCHBBNSA-N |
| XLogP | 2.82 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|