C20H24F3N5O2 — CID 153311239
(1,3-dicyclopropylpyrazol-5-yl)-[(5S)-5-methyl-3-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone (PubChem CID 153311239) has the molecular formula C20H24F3N5O2 and a molecular weight of 423.44 g/mol. Its IUPAC name is (1,3-dicyclopropylpyrazol-5-yl)-[(5S)-5-methyl-3-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone.
| Compound Name | (1,3-dicyclopropylpyrazol-5-yl)-[(5S)-5-methyl-3-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 153311239 |
| Molecular Formula | C20H24F3N5O2 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (1,3-dicyclopropylpyrazol-5-yl)-[(5S)-5-methyl-3-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2cc(C3CC3)nn2C2CC2)Cc2cnc([C@@](C)(O)C(F)(F)F)n21 |
| InChI | InChI=1S/C20H24F3N5O2/c1-11-9-26(10-14-8-24-18(27(11)14)19(2,30)20(21,22)23)17(29)16-7-15(12-3-4-12)25-28(16)13-5-6-13/h7-8,11-13,30H,3-6,9-10H2,1-2H3/t11-,19+/m0/s1 |
| InChIKey | YXRUPTXNZBVUOR-JEOXALJRSA-N |
| XLogP | 3.28 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |