C13H10N6O4 — CID 153311522
4-(2H-triazol-4-yl)-N-(2,4,6-trioxo-1,3-diazinan-5-yl)benzamide (PubChem CID 153311522) has the molecular formula C13H10N6O4 and a molecular weight of 314.26 g/mol. Its IUPAC name is 4-(2H-triazol-4-yl)-N-(2,4,6-trioxo-1,3-diazinan-5-yl)benzamide.
| Compound Name | 4-(2H-triazol-4-yl)-N-(2,4,6-trioxo-1,3-diazinan-5-yl)benzamide |
|---|---|
| PubChem CID | 153311522 |
| Molecular Formula | C13H10N6O4 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 4-(2H-triazol-4-yl)-N-(2,4,6-trioxo-1,3-diazinan-5-yl)benzamide |
| SMILES | O=C1NC(=O)C(NC(=O)c2ccc(-c3cn[nH]n3)cc2)C(=O)N1 |
| InChI | InChI=1S/C13H10N6O4/c20-10(15-9-11(21)16-13(23)17-12(9)22)7-3-1-6(2-4-7)8-5-14-19-18-8/h1-5,9H,(H,15,20)(H,14,18,19)(H2,16,17,21,22,23) |
| InChIKey | KORAXVJKZRMOAZ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|