C47H26F3NO4S3 — CID 153311574
[4-(N-dibenzothiophen-3-ylanilino)-8-naphtho[2,3-b][1]benzothiol-4-yldibenzofuran-2-yl] trifluoromethanesulfonate (PubChem CID 153311574) has the molecular formula C47H26F3NO4S3 and a molecular weight of 821.92 g/mol. Its IUPAC name is [4-(N-dibenzothiophen-3-ylanilino)-8-naphtho[2,3-b][1]benzothiol-4-yldibenzofuran-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(N-dibenzothiophen-3-ylanilino)-8-naphtho[2,3-b][1]benzothiol-4-yldibenzofuran-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 153311574 |
| Molecular Formula | C47H26F3NO4S3 |
| Molecular Weight | 821.92 g/mol |
| Exact Mass | 821.10 |
| IUPAC Name | [4-(N-dibenzothiophen-3-ylanilino)-8-naphtho[2,3-b][1]benzothiol-4-yldibenzofuran-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccc3c(c2)sc2ccccc23)c2oc3ccc(-c4cccc5c4sc4cc6ccccc6cc45)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C47H26F3NO4S3/c48-47(49,50)58(52,53)55-32-25-39-37-22-29(33-14-8-15-36-38-21-27-9-4-5-10-28(27)23-43(38)57-46(33)36)17-20-41(37)54-45(39)40(26-32)51(30-11-2-1-3-12-30)31-18-19-35-34-13-6-7-16-42(34)56-44(35)24-31/h1-26H |
| InChIKey | VVFPLAJDMYZQIU-UHFFFAOYSA-N |
| XLogP | 14.84 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.92 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|