C48H30F3N3O4S — CID 153311582
[4-(N-(4-phenylphenyl)anilino)-8-(9-pyridin-3-ylcarbazol-1-yl)dibenzofuran-2-yl] trifluoromethanesulfonate (PubChem CID 153311582) has the molecular formula C48H30F3N3O4S and a molecular weight of 801.85 g/mol. Its IUPAC name is [4-(N-(4-phenylphenyl)anilino)-8-(9-pyridin-3-ylcarbazol-1-yl)dibenzofuran-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(N-(4-phenylphenyl)anilino)-8-(9-pyridin-3-ylcarbazol-1-yl)dibenzofuran-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 153311582 |
| Molecular Formula | C48H30F3N3O4S |
| Molecular Weight | 801.85 g/mol |
| Exact Mass | 801.19 |
| IUPAC Name | [4-(N-(4-phenylphenyl)anilino)-8-(9-pyridin-3-ylcarbazol-1-yl)dibenzofuran-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccc(-c3ccccc3)cc2)c2oc3ccc(-c4cccc5c6ccccc6n(-c6cccnc6)c45)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C48H30F3N3O4S/c49-48(50,51)59(55,56)58-37-28-42-41-27-33(38-17-9-18-40-39-16-7-8-19-43(39)54(46(38)40)36-15-10-26-52-30-36)22-25-45(41)57-47(42)44(29-37)53(34-13-5-2-6-14-34)35-23-20-32(21-24-35)31-11-3-1-4-12-31/h1-30H |
| InChIKey | GCHKOYQTLXCPCT-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.85 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|