C43H26F3NO4S2 — CID 153311661
[8-dibenzofuran-2-yl-4-(N-(4-phenylphenyl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate (PubChem CID 153311661) has the molecular formula C43H26F3NO4S2 and a molecular weight of 741.81 g/mol. Its IUPAC name is [8-dibenzofuran-2-yl-4-(N-(4-phenylphenyl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate.
| Compound Name | [8-dibenzofuran-2-yl-4-(N-(4-phenylphenyl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 153311661 |
| Molecular Formula | C43H26F3NO4S2 |
| Molecular Weight | 741.81 g/mol |
| Exact Mass | 741.13 |
| IUPAC Name | [8-dibenzofuran-2-yl-4-(N-(4-phenylphenyl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccc(-c3ccccc3)cc2)c2sc3ccc(-c4ccc5oc6ccccc6c5c4)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C43H26F3NO4S2/c44-43(45,46)53(48,49)51-33-25-37-36-24-30(29-17-21-40-35(23-29)34-13-7-8-14-39(34)50-40)18-22-41(36)52-42(37)38(26-33)47(31-11-5-2-6-12-31)32-19-15-28(16-20-32)27-9-3-1-4-10-27/h1-26H |
| InChIKey | VBLNYPAIVCQQAA-UHFFFAOYSA-N |
| XLogP | 12.99 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.81 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|