C10H4F12O5 — CID 153312351
4-[[1,1,2,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]methyl]-1,3-dioxol-2-one (PubChem CID 153312351) has the molecular formula C10H4F12O5 and a molecular weight of 432.11 g/mol. Its IUPAC name is 4-[[1,1,2,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]methyl]-1,3-dioxol-2-one.
| Compound Name | 4-[[1,1,2,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]methyl]-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 153312351 |
| Molecular Formula | C10H4F12O5 |
| Molecular Weight | 432.11 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 4-[[1,1,2,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]methyl]-1,3-dioxol-2-one |
| SMILES | O=c1occ(COC(F)(F)C(F)(OC(C(F)(F)F)C(F)(F)F)C(F)(F)F)o1 |
| InChI | InChI=1S/C10H4F12O5/c11-6(12,13)4(7(14,15)16)27-8(17,9(18,19)20)10(21,22)25-2-3-1-24-5(23)26-3/h1,4H,2H2 |
| InChIKey | BAVSUHLQAHXUKS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.11 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |