C17H20N4O2SSi — CID 153312432
1-[2-(3-trimethylsilylphenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione (PubChem CID 153312432) has the molecular formula C17H20N4O2SSi and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-[2-(3-trimethylsilylphenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-(3-trimethylsilylphenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 153312432 |
| Molecular Formula | C17H20N4O2SSi |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-[2-(3-trimethylsilylphenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione |
| SMILES | C[Si](C)(C)c1cccc(Sc2ncc(N3CCC(=O)NC3=O)cn2)c1 |
| InChI | InChI=1S/C17H20N4O2SSi/c1-25(2,3)14-6-4-5-13(9-14)24-16-18-10-12(11-19-16)21-8-7-15(22)20-17(21)23/h4-6,9-11H,7-8H2,1-3H3,(H,20,22,23) |
| InChIKey | URODILJCZHNBIF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|